Molecular Definition

Canonical SMILES CC[C@@H](C)[C@H](S)C(=O)N[C@@H](C)C(=O)O
Formula C9H17NO3S
Molecular Weight 219.30 da
Stereocenters 3/3