Target Relevance

Molecular Definition

Canonical SMILES COc1ccc2nc(SCc3ccc(cc3)C(=O)Nc4ccccc4N)[nH]c2c1
Formula C22H20N4O2S
Molecular Weight 404.49 da
Stereocenters 0/0