Molecular Definition

Canonical SMILES CC(C)(C)OC(=O)N[C@H](Cc1ccccc1OC(F)(F)F)C(=O)NCc2nc3cccnc3n2C4(CC4)c5ccccc5
Formula C31H32F3N5O4
Molecular Weight 595.61 da
Stereocenters 1/1