Molecular Definition

Canonical SMILES Clc1ccc(cc1)c2ccc(cc2)C(=O)NCC(c3ccccc3)n4ccnc4
Formula C24H20ClN3O
Molecular Weight 401.89 da
Stereocenters 0/1