Molecular Definition

Canonical SMILES CC(C)(C)OC(=O)N[C@H](Cc1ccccc1F)C(=O)NCc2nc3cccnc3n2C4(CC4)c5ccccc5
Formula C30H32FN5O3
Molecular Weight 529.61 da
Stereocenters 1/1