Molecular Definition

Canonical SMILES CC(C)(C)C(=O)N[C@H](Cc1ccccc1C(F)(F)F)C(=O)NCc2nc3cccnc3n2Cc4ccccc4
Formula C29H30F3N5O2
Molecular Weight 537.58 da
Stereocenters 1/1