Target Relevance

Molecular Definition

Canonical SMILES CS(=O)(=O)c1nc2cc(Cl)c(Cl)cc2nc1C(F)(F)F
Formula C10H5Cl2F3N2O2S
Molecular Weight 345.13 da
Stereocenters 0/0