Target Relevance

Molecular Definition

Canonical SMILES CC(=O)NC1N=C(c2ccccc2)c3ccccc3N(CC(=O)NCCc4cccc5ccccc45)C1=O
Formula C31H28N4O3
Molecular Weight 504.58 da
Stereocenters 0/1