Molecular Definition

Canonical SMILES CC1=CNC(=O)N(CCCN2CCN(CC2)c3ccc(F)cc3OCC(F)(F)F)C1=O
Formula C20H24F4N4O3
Molecular Weight 444.42 da
Stereocenters 0/0