Target Relevance

Molecular Definition

Canonical SMILES CC(=O)CCCC(=O)NC1N=C(c2ccccc2)c3ccccc3N(CC(=O)NCCCc4cccc(Cl)c4)C1=O
Formula C32H33ClN4O4
Molecular Weight 573.08 da
Stereocenters 0/1