Target Relevance

Molecular Definition

Canonical SMILES CC(=O)NC1N=C(c2ccccc2)c3ccccc3N(CC(=O)NCCc4ccc(Cl)c(Cl)c4)C1=O
Formula C27H24Cl2N4O3
Molecular Weight 523.41 da
Stereocenters 0/1