Target Relevance

Molecular Definition

Canonical SMILES CC1(C)OC(=Nc2ccc(cc12)c3cc(Br)cc(c3)C#N)S
Formula C17H13BrN2OS
Molecular Weight 373.27 da
Stereocenters 0/0