Target Relevance

Molecular Definition

Canonical SMILES OC(=O)C1=Cc2cc3CCCN4CCCc(c2OC1=O)c34
Formula C16H15NO4
Molecular Weight 285.29 da
Stereocenters 0/0