Molecular Definition

Canonical SMILES [O-][N+](=O)c1ccc(CCN2CCN(CCc3ccc(cc3)n4cnnn4)CC2)cc1
Formula C21H25N7O2
Molecular Weight 407.47 da
Stereocenters 0/0