Molecular Definition

Canonical SMILES COc1cc2C(=O)OCc2cc1CCN3CCN(CC3)C(=O)Cc4ccc(cc4)n5cnnn5
Formula C24H26N6O4
Molecular Weight 462.50 da
Stereocenters 0/0