Molecular Definition

Canonical SMILES FC(F)(F)c1cc(CC(=O)N2CCN(CCc3ccc4C(=O)OCc4c3)CC2)ccc1n5cnnn5
Formula C24H23F3N6O3
Molecular Weight 500.47 da
Stereocenters 0/0