Molecular Definition

Canonical SMILES Cc1ccnn1CC(=O)N2CCc3cc(ccc23)c4cn(C)c5ncnc(N)c45
Formula C21H21N7O
Molecular Weight 387.44 da
Stereocenters 0/0