Molecular Definition

Canonical SMILES Cn1cc(c2ccc3N(CCc3c2)C(=O)Cc4cccnc4)c5c(N)ncnc15
Formula C22H20N6O
Molecular Weight 384.43 da
Stereocenters 0/0