Molecular Definition

Canonical SMILES COc1cc2c(NC3CCN(CC3)C4CC4)nc(nc2cc1OCCCN5CCCC5)N6CCC(F)(F)CC6
Formula C29H42F2N6O2
Molecular Weight 544.68 da
Stereocenters 0/0