Molecular Definition

Canonical SMILES COc1cc2c(NC3CCN(CC3)C4CC4)nc(nc2cc1OCCCN5CCCC5)N6CCS(=O)(=O)CC6
Formula C28H42N6O4S
Molecular Weight 558.74 da
Stereocenters 0/0