Molecular Definition

Canonical SMILES O=C(COc1cccc2ccccc12)NNC(=S)NCCCCC3CCCCC3
Formula C23H31N3O2S
Molecular Weight 413.58 da
Stereocenters 0/0