Molecular Definition

Canonical SMILES O=C(NC1=CC(=CNC1=O)c2ccncc2)[C@H](Cc3ccccc3)NCc4cncs4
Formula C23H21N5O2S
Molecular Weight 431.51 da
Stereocenters 1/1