Molecular Definition

Canonical SMILES O=C(Nc1cnc(s1)c2ccncc2)[C@H](Cc3ccccc3)NCc4cncs4
Formula C21H19N5OS2
Molecular Weight 421.54 da
Stereocenters 1/1