Molecular Definition

Canonical SMILES O=C(Nc1cc(n[nH]1)c2ccncc2)[C@H](Cc3ccccc3)NCc4cncs4
Formula C21H20N6OS
Molecular Weight 404.49 da
Stereocenters 1/1