Molecular Definition

Canonical SMILES CCOC(=O)CN[C@@H](Cc1ccccc1)C(=O)Nc2cc(nn2C)c3ccncc3
Formula C22H25N5O3
Molecular Weight 407.47 da
Stereocenters 1/1