Molecular Definition

Canonical SMILES CNc1cc(ccn1)c2cc(NC(=O)[C@H](Cc3ccc(F)cc3)NCC(=O)N)n(C)n2
Formula C21H24FN7O2
Molecular Weight 425.46 da
Stereocenters 1/1