Molecular Definition

Canonical SMILES CNc1cc(ccn1)c2cc(NC(=O)[C@H](Cc3ccc(F)cc3)NCC(=O)O)n(C)n2
Formula C21H23FN6O3
Molecular Weight 426.44 da
Stereocenters 1/1