Molecular Definition

Canonical SMILES CNc1cc(ccn1)c2cc(NC(=O)[C@H](Cc3ccc(F)cc3)NCc4nn[nH]n4)n(C)n2
Formula C21H23FN10O
Molecular Weight 450.47 da
Stereocenters 1/1