Molecular Definition

Canonical SMILES CNc1cc(ccn1)c2cc(NC(=O)[C@H](Cc3ccc(F)cc3)NCc4c[nH]nn4)n(C)n2
Formula C22H24FN9O
Molecular Weight 449.48 da
Stereocenters 1/1