Molecular Definition

Canonical SMILES CNc1cc(ccn1)c2cc(NC(=O)[C@H](Cc3ccccc3)NCc4cncs4)n(C)n2
Formula C23H25N7OS
Molecular Weight 447.56 da
Stereocenters 1/1