Molecular Definition

Canonical SMILES COc1ccc(cc1)C2=NC(NC(=O)OCc3ccccc3)c4nnc(C)n4c5ccccc25
Formula C26H23N5O3
Molecular Weight 453.49 da
Stereocenters 0/1