Molecular Definition

Canonical SMILES Cc1nnc2C(NC(=O)NCc3ccccc3)N=C(c4ccccc4)c5ccccc5n12
Formula C25H22N6O
Molecular Weight 422.48 da
Stereocenters 0/1