Molecular Definition

Canonical SMILES COc1ccc(C(=O)c2ccncc2)c3cc(nn13)C(F)(F)F
Formula C15H10F3N3O2
Molecular Weight 321.25 da
Stereocenters 0/0