Molecular Definition

Canonical SMILES O=C(NCCc1ccc(cc1)S(=O)(=O)c2ccccc2)c3cc4cnccc4[nH]3
Formula C22H19N3O3S
Molecular Weight 405.47 da
Stereocenters 0/0