Target Relevance

Molecular Definition

Canonical SMILES CCc1ccc(cc1)C2=NN(C)C3=NC(=O)N(Cc4ccccc4)C(=O)C3=N2
Formula C21H19N5O2
Molecular Weight 373.41 da
Stereocenters 0/0