Molecular Definition

Canonical SMILES O[C@H]1CCCN(C1)S(=O)(=O)c2ccc(CNC(=O)N3Cc4ccncc4C3)cc2
Formula C20H24N4O4S
Molecular Weight 416.49 da
Stereocenters 1/1