Molecular Definition

Canonical SMILES Oc1ccc2C(=O)C(=COc2c1O)c3cccc(Cl)c3
Formula C15H9ClO4
Molecular Weight 288.68 da
Stereocenters 0/0