Molecular Definition

Canonical SMILES CCOCc1c(cnn1c2ncc(C)c(n2)N3CCC3)C(=O)NCc4cncn4C
Formula C20H26N8O2
Molecular Weight 410.47 da
Stereocenters 0/0