Molecular Definition

Canonical SMILES CCOCc1c(cnn1c2ncc(C)c(NC3CCC3)n2)C(=O)NCc4cncn4C
Formula C21H28N8O2
Molecular Weight 424.50 da
Stereocenters 0/0