Molecular Definition

Canonical SMILES CCOCc1c(cnn1c2ncc(C)c(OCC)n2)C(=O)NCc3cncn3C
Formula C19H25N7O3
Molecular Weight 399.45 da
Stereocenters 0/0