Molecular Definition

Canonical SMILES CCCCc1c(cnn1c2ncc(C)c(n2)c3cccs3)C(=O)NCc4ccnn4C
Formula C22H25N7OS
Molecular Weight 435.55 da
Stereocenters 0/0