Molecular Definition

Canonical SMILES CCCCc1c(cnn1c2ncc(C)c(n2)c3cccs3)C(=O)NCc4cnc(C)n4C
Formula C23H27N7OS
Molecular Weight 449.57 da
Stereocenters 0/0