Molecular Definition

Canonical SMILES Nc1ncc(c2cnn(c2)[C@@H]3CC[C@@H](O)CC3)c4c(C(F)F)c(oc14)c5cccc6nnsc56
Formula C23H20F2N6O2S
Molecular Weight 482.51 da
Stereocenters 2/2