Molecular Definition

Canonical SMILES Nc1ncc(c2cnn(c2)[C@@H]3CC[C@@H](O)CC3)c4c(C#N)c(oc14)c5cccc6nnsc56
Formula C23H19N7O2S
Molecular Weight 457.51 da
Stereocenters 2/2