Molecular Definition

Canonical SMILES Nc1ncc(c2cnn(c2)[C@@H]3CC[C@@H](O)CC3)c4cc(oc14)c5cccc6nnsc56
Formula C22H20N6O2S
Molecular Weight 432.50 da
Stereocenters 2/2