Molecular Definition

Canonical SMILES CN(C)c1ccc(cc1)C(C\C(=N/O)\c2ccncc2)c3ccc(C)cc3
Formula C23H25N3O
Molecular Weight 359.46 da
Stereocenters 0/1