Molecular Definition

Canonical SMILES Cc1nc2c(NCc3cccc(c3)S(=O)(=O)C)nccn2c1c4ccc(O)c(F)c4
Formula C21H19FN4O3S
Molecular Weight 426.46 da
Stereocenters 0/0