Molecular Definition

Canonical SMILES CC(=O)N1CCC(CC1)n2cc(cn2)c3cnc(N)c4oc(cc34)c5cccc6nnsc56
Formula C23H21N7O2S
Molecular Weight 459.52 da
Stereocenters 0/0