Target Relevance

Molecular Definition

Canonical SMILES CC(=O)NC1N=C(c2ccccc2)c3ccccc3N(CC(=O)NCCc4cccc(Cl)c4)C1=O
Formula C27H25ClN4O3
Molecular Weight 488.97 da
Stereocenters 0/1