Molecular Definition

Canonical SMILES CCC(CC)(c1ccc(N)c(C)c1)c2ccc(O)c(C)c2
Formula C19H25NO
Molecular Weight 283.41 da
Stereocenters 0/0